About 3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane
3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane (PubChem CID 175325122) has the molecular formula C34H44O4
and a molecular weight of 516.72 g/mol. Its IUPAC name is 3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane.
Molecular Properties
| Compound Name | 3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane |
| PubChem CID | 175325122 |
| Molecular Formula | C34H44O4 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | 3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane |
| SMILES | CC.Cc1cc(O)c(-c2ccc(O)c(O)c2-c2cc(C3CCCCC3)c(C)cc2O)cc1C1CCCCC1 |
| InChI | InChI=1S/C32H38O4.C2H6/c1-19-15-29(34)26(17-24(19)21-9-5-3-6-10-21)23-13-14-28(33)32(36)31(23)27-18-25(20(2)16-30(27)35)22-11-7-4-8-12-22;1-2/h13-18,21-22,33-36H,3-12H2,1-2H3;1-2H3 |
| InChIKey | ZBCUSNNQQFWOKD-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane?
The IUPAC name of 3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane (CID 175325122) is 3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane.
What is the SMILES notation for 3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane?
The canonical SMILES for 3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane is CC.Cc1cc(O)c(-c2ccc(O)c(O)c2-c2cc(C3CCCCC3)c(C)cc2O)cc1C1CCCCC1.
What is the InChIKey of 3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane?
The InChIKey is ZBCUSNNQQFWOKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H38O4.C2H6/c1-19-15-29(34)26(17-24(19)21-9-5-3-6-10-21)23-13-14-28(33)32(36)31(23)27-18-25(20(2)16-30(27)35)22-11-7-4-8-12-22;1-2/h13-18,21-22,33-36H,3-12H2,1-2H3;1-2H3.
What are the key properties of 3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane?
3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane has a molecular weight of 516.72 g/mol, XLogP of 9.58, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(5-cyclohexyl-2-hydroxy-4-methylphenyl)benzene-1,2-diol;ethane is sourced from PubChem (CID 175325122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).