About 3-(1,3-oxazol-2-yl)propan-1-ol;quinoline
3-(1,3-oxazol-2-yl)propan-1-ol;quinoline (PubChem CID 175325233) has the molecular formula C15H16N2O2
and a molecular weight of 256.31 g/mol. Its IUPAC name is 3-(1,3-oxazol-2-yl)propan-1-ol;quinoline.
Molecular Properties
| Compound Name | 3-(1,3-oxazol-2-yl)propan-1-ol;quinoline |
| PubChem CID | 175325233 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-(1,3-oxazol-2-yl)propan-1-ol;quinoline |
| SMILES | OCCCc1ncco1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C6H9NO2/c1-2-6-9-8(4-1)5-3-7-10-9;8-4-1-2-6-7-3-5-9-6/h1-7H;3,5,8H,1-2,4H2 |
| InChIKey | CCKYBIDWZPYARL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-oxazol-2-yl)propan-1-ol;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-oxazol-2-yl)propan-1-ol;quinoline?
The IUPAC name of 3-(1,3-oxazol-2-yl)propan-1-ol;quinoline (CID 175325233) is 3-(1,3-oxazol-2-yl)propan-1-ol;quinoline.
What is the SMILES notation for 3-(1,3-oxazol-2-yl)propan-1-ol;quinoline?
The canonical SMILES for 3-(1,3-oxazol-2-yl)propan-1-ol;quinoline is OCCCc1ncco1.c1ccc2ncccc2c1.
What is the InChIKey of 3-(1,3-oxazol-2-yl)propan-1-ol;quinoline?
The InChIKey is CCKYBIDWZPYARL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H9NO2/c1-2-6-9-8(4-1)5-3-7-10-9;8-4-1-2-6-7-3-5-9-6/h1-7H;3,5,8H,1-2,4H2.
What are the key properties of 3-(1,3-oxazol-2-yl)propan-1-ol;quinoline?
3-(1,3-oxazol-2-yl)propan-1-ol;quinoline has a molecular weight of 256.31 g/mol, XLogP of 2.83, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-oxazol-2-yl)propan-1-ol;quinoline is sourced from PubChem (CID 175325233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).