About 1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate
1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate (PubChem CID 175325340) has the molecular formula C13H17F3N2O4S
and a molecular weight of 354.35 g/mol. Its IUPAC name is 1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate.
Molecular Properties
| Compound Name | 1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate |
| PubChem CID | 175325340 |
| Molecular Formula | C13H17F3N2O4S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate |
| SMILES | CC(OC(=O)S(=O)(=O)NC1(C(F)(F)F)CCCC1)n1cccc1 |
| InChI | InChI=1S/C13H17F3N2O4S/c1-10(18-8-4-5-9-18)22-11(19)23(20,21)17-12(13(14,15)16)6-2-3-7-12/h4-5,8-10,17H,2-3,6-7H2,1H3 |
| InChIKey | SXZKOFSTYVBYRM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate?
The IUPAC name of 1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate (CID 175325340) is 1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate.
What is the SMILES notation for 1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate?
The canonical SMILES for 1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate is CC(OC(=O)S(=O)(=O)NC1(C(F)(F)F)CCCC1)n1cccc1.
What is the InChIKey of 1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate?
The InChIKey is SXZKOFSTYVBYRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3N2O4S/c1-10(18-8-4-5-9-18)22-11(19)23(20,21)17-12(13(14,15)16)6-2-3-7-12/h4-5,8-10,17H,2-3,6-7H2,1H3.
What are the key properties of 1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate?
1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate has a molecular weight of 354.35 g/mol, XLogP of 2.94, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrol-1-ylethyl [1-(trifluoromethyl)cyclopentyl]sulfamoylformate is sourced from PubChem (CID 175325340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).