About ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate
ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate (PubChem CID 175325734) has the molecular formula C10H7ClN2O6
and a molecular weight of 286.63 g/mol. Its IUPAC name is ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate |
| PubChem CID | 175325734 |
| Molecular Formula | C10H7ClN2O6 |
| Molecular Weight | 286.63 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(OC(=O)c2cnc(Cl)o2)o1 |
| InChI | InChI=1S/C10H7ClN2O6/c1-2-16-7(14)5-4-13-10(18-5)19-8(15)6-3-12-9(11)17-6/h3-4H,2H2,1H3 |
| InChIKey | FERJEVLTRKWDJB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.63 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate?
The IUPAC name of ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate (CID 175325734) is ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate?
The canonical SMILES for ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate is CCOC(=O)c1cnc(OC(=O)c2cnc(Cl)o2)o1.
What is the InChIKey of ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate?
The InChIKey is FERJEVLTRKWDJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClN2O6/c1-2-16-7(14)5-4-13-10(18-5)19-8(15)6-3-12-9(11)17-6/h3-4H,2H2,1H3.
What are the key properties of ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate?
ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate has a molecular weight of 286.63 g/mol, XLogP of 1.71, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-chloro-1,3-oxazole-5-carbonyl)oxy-1,3-oxazole-5-carboxylate is sourced from PubChem (CID 175325734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).