About bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol
bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol (PubChem CID 175325803) has the molecular formula C10H14N2O5
and a molecular weight of 242.23 g/mol. Its IUPAC name is bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol.
Molecular Properties
| Compound Name | bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol |
| PubChem CID | 175325803 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol |
| SMILES | O=C(C1=NCCO1)C1=NCCO1.OCC1CO1 |
| InChI | InChI=1S/C7H8N2O3.C3H6O2/c10-5(6-8-1-3-11-6)7-9-2-4-12-7;4-1-3-2-5-3/h1-4H2;3-4H,1-2H2 |
| InChIKey | CQRNXZXCRBWTOK-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol?
The IUPAC name of bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol (CID 175325803) is bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol.
What is the SMILES notation for bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol?
The canonical SMILES for bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol is O=C(C1=NCCO1)C1=NCCO1.OCC1CO1.
What is the InChIKey of bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol?
The InChIKey is CQRNXZXCRBWTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3.C3H6O2/c10-5(6-8-1-3-11-6)7-9-2-4-12-7;4-1-3-2-5-3/h1-4H2;3-4H,1-2H2.
What are the key properties of bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol?
bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol has a molecular weight of 242.23 g/mol, XLogP of -1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4,5-dihydro-1,3-oxazol-2-yl)methanone;oxiran-2-ylmethanol is sourced from PubChem (CID 175325803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).