About hexakis(1-adamantyl)-λ6-sulfane
hexakis(1-adamantyl)-λ6-sulfane (PubChem CID 175326433) has the molecular formula C60H90S
and a molecular weight of 843.45 g/mol. Its IUPAC name is hexakis(1-adamantyl)-λ6-sulfane.
Molecular Properties
| Compound Name | hexakis(1-adamantyl)-λ6-sulfane |
| PubChem CID | 175326433 |
| Molecular Formula | C60H90S |
| Molecular Weight | 843.45 g/mol |
| Exact Mass | 842.68 |
| IUPAC Name | hexakis(1-adamantyl)-λ6-sulfane |
| SMILES | C1C2CC3CC1CC(S(C14CC5CC(CC(C5)C1)C4)(C14CC5CC(CC(C5)C1)C4)(C14CC5CC(CC(C5)C1)C4)(C14CC5CC(CC(C5)C1)C4)C14CC5CC(CC(C5)C1)C4)(C2)C3 |
| InChI | InChI=1S/C60H90S/c1-37-2-39-3-38(1)20-55(19-37,21-39)61(56-22-40-4-41(23-56)6-42(5-40)24-56,57-25-43-7-44(26-57)9-45(8-43)27-57,58-28-46-10-47(29-58)12-48(11-46)30-58,59-31-49-13-50(32-59)15-51(14-49)33-59)60-34-52-16-53(35-60)18-54(17-52)36-60/h37-54H,1-36H2 |
| InChIKey | LGZVJCLPCMVRGE-UHFFFAOYSA-N |
| XLogP | 15.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 843.45 |
| LogP ≤ 5 | 15.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hexakis(1-adamantyl)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexakis(1-adamantyl)-λ6-sulfane?
The IUPAC name of hexakis(1-adamantyl)-λ6-sulfane (CID 175326433) is hexakis(1-adamantyl)-λ6-sulfane.
What is the SMILES notation for hexakis(1-adamantyl)-λ6-sulfane?
The canonical SMILES for hexakis(1-adamantyl)-λ6-sulfane is C1C2CC3CC1CC(S(C14CC5CC(CC(C5)C1)C4)(C14CC5CC(CC(C5)C1)C4)(C14CC5CC(CC(C5)C1)C4)(C14CC5CC(CC(C5)C1)C4)C14CC5CC(CC(C5)C1)C4)(C2)C3.
What is the InChIKey of hexakis(1-adamantyl)-λ6-sulfane?
The InChIKey is LGZVJCLPCMVRGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C60H90S/c1-37-2-39-3-38(1)20-55(19-37,21-39)61(56-22-40-4-41(23-56)6-42(5-40)24-56,57-25-43-7-44(26-57)9-45(8-43)27-57,58-28-46-10-47(29-58)12-48(11-46)30-58,59-31-49-13-50(32-59)15-51(14-49)33-59)60-34-52-16-53(35-60)18-54(17-52)36-60/h37-54H,1-36H2.
What are the key properties of hexakis(1-adamantyl)-λ6-sulfane?
hexakis(1-adamantyl)-λ6-sulfane has a molecular weight of 843.45 g/mol, XLogP of 15.68, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexakis(1-adamantyl)-λ6-sulfane is sourced from PubChem (CID 175326433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).