C24H36OSm — CID 175326473
2,2-bis(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)oxolane;samarium (PubChem CID 175326473) has the molecular formula C24H36OSm and a molecular weight of 490.91 g/mol. Its IUPAC name is 2,2-bis(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)oxolane;samarium.
| Compound Name | 2,2-bis(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)oxolane;samarium |
|---|---|
| PubChem CID | 175326473 |
| Molecular Formula | C24H36OSm |
| Molecular Weight | 490.91 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 2,2-bis(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)oxolane;samarium |
| SMILES | CC1=C(C)C(C)(C)C(C2(C3=C(C)C(C)=C(C)C3(C)C)CCCO2)=C1C.[Sm] |
| InChI | InChI=1S/C24H36O.Sm/c1-14-16(3)20(22(7,8)18(14)5)24(12-11-13-25-24)21-17(4)15(2)19(6)23(21,9)10;/h11-13H2,1-10H3; |
| InChIKey | OHWDXTLDYGVEAX-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.91 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |