C19H19F3O2 — CID 175327024
ethyl 2-[4-methyl-3-(3,4,5-trifluoro-2-methylphenyl)phenyl]propanoate (PubChem CID 175327024) has the molecular formula C19H19F3O2 and a molecular weight of 336.35 g/mol. Its IUPAC name is ethyl 2-[4-methyl-3-(3,4,5-trifluoro-2-methylphenyl)phenyl]propanoate.
| Compound Name | ethyl 2-[4-methyl-3-(3,4,5-trifluoro-2-methylphenyl)phenyl]propanoate |
|---|---|
| PubChem CID | 175327024 |
| Molecular Formula | C19H19F3O2 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | ethyl 2-[4-methyl-3-(3,4,5-trifluoro-2-methylphenyl)phenyl]propanoate |
| SMILES | CCOC(=O)C(C)c1ccc(C)c(-c2cc(F)c(F)c(F)c2C)c1 |
| InChI | InChI=1S/C19H19F3O2/c1-5-24-19(23)11(3)13-7-6-10(2)14(8-13)15-9-16(20)18(22)17(21)12(15)4/h6-9,11H,5H2,1-4H3 |
| InChIKey | UBPDZSYBRXFAKR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|