C10H16O6 — CID 175327133
3-(cyclobuten-1-yl)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 175327133) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is 3-(cyclobuten-1-yl)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 3-(cyclobuten-1-yl)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 175327133 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 3-(cyclobuten-1-yl)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | O=CC(O)C(O)(C1=CCC1)C(O)C(O)CO |
| InChI | InChI=1S/C10H16O6/c11-4-7(13)9(15)10(16,8(14)5-12)6-2-1-3-6/h2,5,7-9,11,13-16H,1,3-4H2 |
| InChIKey | UTOOEOKUJIVHQL-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|