C21H21N3O2 — CID 175327614
1H-1,4-benzodiazepine;1,3-dimethyl-3-phenylpyrrolidine-2,5-dione (PubChem CID 175327614) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1H-1,4-benzodiazepine;1,3-dimethyl-3-phenylpyrrolidine-2,5-dione.
| Compound Name | 1H-1,4-benzodiazepine;1,3-dimethyl-3-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 175327614 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1H-1,4-benzodiazepine;1,3-dimethyl-3-phenylpyrrolidine-2,5-dione |
| SMILES | C1=CNc2ccccc2C=N1.CN1C(=O)CC(C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C12H13NO2.C9H8N2/c1-12(9-6-4-3-5-7-9)8-10(14)13(2)11(12)15;1-2-4-9-8(3-1)7-10-5-6-11-9/h3-7H,8H2,1-2H3;1-7,11H |
| InChIKey | ZMACIIQRNYCOBV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|