About azido 2-azido-2-(2-hydroxyethoxy)acetate
azido 2-azido-2-(2-hydroxyethoxy)acetate (PubChem CID 175327639) has the molecular formula C4H6N6O4
and a molecular weight of 202.13 g/mol. Its IUPAC name is azido 2-azido-2-(2-hydroxyethoxy)acetate.
Molecular Properties
| Compound Name | azido 2-azido-2-(2-hydroxyethoxy)acetate |
| PubChem CID | 175327639 |
| Molecular Formula | C4H6N6O4 |
| Molecular Weight | 202.13 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | azido 2-azido-2-(2-hydroxyethoxy)acetate |
| SMILES | [N-]=[N+]=NOC(=O)C(N=[N+]=[N-])OCCO |
| InChI | InChI=1S/C4H6N6O4/c5-8-7-3(13-2-1-11)4(12)14-10-9-6/h3,11H,1-2H2 |
| InChIKey | MUCVXAGORTWMPA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 153.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.13 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azido 2-azido-2-(2-hydroxyethoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azido 2-azido-2-(2-hydroxyethoxy)acetate?
The IUPAC name of azido 2-azido-2-(2-hydroxyethoxy)acetate (CID 175327639) is azido 2-azido-2-(2-hydroxyethoxy)acetate.
What is the SMILES notation for azido 2-azido-2-(2-hydroxyethoxy)acetate?
The canonical SMILES for azido 2-azido-2-(2-hydroxyethoxy)acetate is [N-]=[N+]=NOC(=O)C(N=[N+]=[N-])OCCO.
What is the InChIKey of azido 2-azido-2-(2-hydroxyethoxy)acetate?
The InChIKey is MUCVXAGORTWMPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N6O4/c5-8-7-3(13-2-1-11)4(12)14-10-9-6/h3,11H,1-2H2.
What are the key properties of azido 2-azido-2-(2-hydroxyethoxy)acetate?
azido 2-azido-2-(2-hydroxyethoxy)acetate has a molecular weight of 202.13 g/mol, XLogP of 0.40, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azido 2-azido-2-(2-hydroxyethoxy)acetate is sourced from PubChem (CID 175327639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).