About [2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine
[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine (PubChem CID 175327692) has the molecular formula C22H25N7O3
and a molecular weight of 435.49 g/mol. Its IUPAC name is [2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | [2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine |
| PubChem CID | 175327692 |
| Molecular Formula | C22H25N7O3 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | [2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine |
| SMILES | CN1CCN(c2ccc([N+](=O)[O-])cc2C(=O)c2ccccc2)CC1.Nc1cc(N)ncn1 |
| InChI | InChI=1S/C18H19N3O3.C4H6N4/c1-19-9-11-20(12-10-19)17-8-7-15(21(23)24)13-16(17)18(22)14-5-3-2-4-6-14;5-3-1-4(6)8-2-7-3/h2-8,13H,9-12H2,1H3;1-2H,(H4,5,6,7,8) |
| InChIKey | WEXVBJBFRZHREF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 144.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine?
The IUPAC name of [2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine (CID 175327692) is [2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine.
What is the SMILES notation for [2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine?
The canonical SMILES for [2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine is CN1CCN(c2ccc([N+](=O)[O-])cc2C(=O)c2ccccc2)CC1.Nc1cc(N)ncn1.
What is the InChIKey of [2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine?
The InChIKey is WEXVBJBFRZHREF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O3.C4H6N4/c1-19-9-11-20(12-10-19)17-8-7-15(21(23)24)13-16(17)18(22)14-5-3-2-4-6-14;5-3-1-4(6)8-2-7-3/h2-8,13H,9-12H2,1H3;1-2H,(H4,5,6,7,8).
What are the key properties of [2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine?
[2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine has a molecular weight of 435.49 g/mol, XLogP of 2.22, 4 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methylpiperazin-1-yl)-5-nitrophenyl]-phenylmethanone;pyrimidine-4,6-diamine is sourced from PubChem (CID 175327692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).