C9H17N3O3 — CID 175328032
1-methylpiperazine-2-carboxylic acid;prop-2-enamide (PubChem CID 175328032) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 1-methylpiperazine-2-carboxylic acid;prop-2-enamide.
| Compound Name | 1-methylpiperazine-2-carboxylic acid;prop-2-enamide |
|---|---|
| PubChem CID | 175328032 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 1-methylpiperazine-2-carboxylic acid;prop-2-enamide |
| SMILES | C=CC(N)=O.CN1CCNCC1C(=O)O |
| InChI | InChI=1S/C6H12N2O2.C3H5NO/c1-8-3-2-7-4-5(8)6(9)10;1-2-3(4)5/h5,7H,2-4H2,1H3,(H,9,10);2H,1H2,(H2,4,5) |
| InChIKey | SDZQVYPHINLSLD-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|