C20H31F3O4SSi — CID 175328154
tert-butyl-dimethyl-[[4-methyl-4-(2,4,5-trifluoro-3-methylphenyl)sulfonyloxan-2-yl]methoxy]silane (PubChem CID 175328154) has the molecular formula C20H31F3O4SSi and a molecular weight of 452.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[4-methyl-4-(2,4,5-trifluoro-3-methylphenyl)sulfonyloxan-2-yl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[4-methyl-4-(2,4,5-trifluoro-3-methylphenyl)sulfonyloxan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 175328154 |
| Molecular Formula | C20H31F3O4SSi |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | tert-butyl-dimethyl-[[4-methyl-4-(2,4,5-trifluoro-3-methylphenyl)sulfonyloxan-2-yl]methoxy]silane |
| SMILES | Cc1c(F)c(F)cc(S(=O)(=O)C2(C)CCOC(CO[Si](C)(C)C(C)(C)C)C2)c1F |
| InChI | InChI=1S/C20H31F3O4SSi/c1-13-17(22)15(21)10-16(18(13)23)28(24,25)20(5)8-9-26-14(11-20)12-27-29(6,7)19(2,3)4/h10,14H,8-9,11-12H2,1-7H3 |
| InChIKey | NMHKKCBWBYNTTK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|