About 2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid
2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid (PubChem CID 175328223) has the molecular formula C10H23N3O5S
and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid.
Molecular Properties
| Compound Name | 2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid |
| PubChem CID | 175328223 |
| Molecular Formula | C10H23N3O5S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid |
| SMILES | CC(C)(C)C(=O)O.NCCOS(=O)(=O)NC1CNC1 |
| InChI | InChI=1S/C5H13N3O3S.C5H10O2/c6-1-2-11-12(9,10)8-5-3-7-4-5;1-5(2,3)4(6)7/h5,7-8H,1-4,6H2;1-3H3,(H,6,7) |
| InChIKey | BMYOUQICCORYHD-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid?
The IUPAC name of 2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid (CID 175328223) is 2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid.
What is the SMILES notation for 2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid?
The canonical SMILES for 2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid is CC(C)(C)C(=O)O.NCCOS(=O)(=O)NC1CNC1.
What is the InChIKey of 2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid?
The InChIKey is BMYOUQICCORYHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3O3S.C5H10O2/c6-1-2-11-12(9,10)8-5-3-7-4-5;1-5(2,3)4(6)7/h5,7-8H,1-4,6H2;1-3H3,(H,6,7).
What are the key properties of 2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid?
2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid has a molecular weight of 297.38 g/mol, XLogP of -1.12, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl N-(azetidin-3-yl)sulfamate;2,2-dimethylpropanoic acid is sourced from PubChem (CID 175328223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).