About 1-bromo-2-phenylbenzene;propanal
1-bromo-2-phenylbenzene;propanal (PubChem CID 175328871) has the molecular formula C15H15BrO
and a molecular weight of 291.19 g/mol. Its IUPAC name is 1-bromo-2-phenylbenzene;propanal.
Molecular Properties
| Compound Name | 1-bromo-2-phenylbenzene;propanal |
| PubChem CID | 175328871 |
| Molecular Formula | C15H15BrO |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1-bromo-2-phenylbenzene;propanal |
| SMILES | Brc1ccccc1-c1ccccc1.CCC=O |
| InChI | InChI=1S/C12H9Br.C3H6O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2-3-4/h1-9H;3H,2H2,1H3 |
| InChIKey | PHRRJSAQMOQEAI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-phenylbenzene;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-phenylbenzene;propanal?
The IUPAC name of 1-bromo-2-phenylbenzene;propanal (CID 175328871) is 1-bromo-2-phenylbenzene;propanal.
What is the SMILES notation for 1-bromo-2-phenylbenzene;propanal?
The canonical SMILES for 1-bromo-2-phenylbenzene;propanal is Brc1ccccc1-c1ccccc1.CCC=O.
What is the InChIKey of 1-bromo-2-phenylbenzene;propanal?
The InChIKey is PHRRJSAQMOQEAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Br.C3H6O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-2-3-4/h1-9H;3H,2H2,1H3.
What are the key properties of 1-bromo-2-phenylbenzene;propanal?
1-bromo-2-phenylbenzene;propanal has a molecular weight of 291.19 g/mol, XLogP of 4.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-phenylbenzene;propanal is sourced from PubChem (CID 175328871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).