C18H15Cl2N3O2 — CID 175328918
7-chloro-1-(2-chlorophenyl)-4-[(3R)-3-hydroxypyrrolidin-1-yl]-1,8-naphthyridin-2-one (PubChem CID 175328918) has the molecular formula C18H15Cl2N3O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is 7-chloro-1-(2-chlorophenyl)-4-[(3R)-3-hydroxypyrrolidin-1-yl]-1,8-naphthyridin-2-one.
| Compound Name | 7-chloro-1-(2-chlorophenyl)-4-[(3R)-3-hydroxypyrrolidin-1-yl]-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 175328918 |
| Molecular Formula | C18H15Cl2N3O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 7-chloro-1-(2-chlorophenyl)-4-[(3R)-3-hydroxypyrrolidin-1-yl]-1,8-naphthyridin-2-one |
| SMILES | O=c1cc(N2CC[C@@H](O)C2)c2ccc(Cl)nc2n1-c1ccccc1Cl |
| InChI | InChI=1S/C18H15Cl2N3O2/c19-13-3-1-2-4-14(13)23-17(25)9-15(22-8-7-11(24)10-22)12-5-6-16(20)21-18(12)23/h1-6,9,11,24H,7-8,10H2/t11-/m1/s1 |
| InChIKey | AXXDCKIIUQXZHB-LLVKDONJSA-N |
| XLogP | 3.26 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|