About hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol
hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol (PubChem CID 175329142) has the molecular formula C8H20O5P+
and a molecular weight of 227.22 g/mol. Its IUPAC name is hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol |
| PubChem CID | 175329142 |
| Molecular Formula | C8H20O5P+ |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol |
| SMILES | COC(C)(C)C(C)(C)O.CO[P+](=O)O |
| InChI | InChI=1S/C7H16O2.CH3O3P/c1-6(2,8)7(3,4)9-5;1-4-5(2)3/h8H,1-5H3;1H3/p+1 |
| InChIKey | IENRQPMAZAAARE-UHFFFAOYSA-O |
| XLogP | 1.46 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol?
The IUPAC name of hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol (CID 175329142) is hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol.
What is the SMILES notation for hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol?
The canonical SMILES for hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol is COC(C)(C)C(C)(C)O.CO[P+](=O)O.
What is the InChIKey of hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol?
The InChIKey is IENRQPMAZAAARE-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H16O2.CH3O3P/c1-6(2,8)7(3,4)9-5;1-4-5(2)3/h8H,1-5H3;1H3/p+1.
What are the key properties of hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol?
hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol has a molecular weight of 227.22 g/mol, XLogP of 1.46, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-methoxy-oxophosphanium;3-methoxy-2,3-dimethylbutan-2-ol is sourced from PubChem (CID 175329142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).