About 1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride
1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride (PubChem CID 175329155) has the molecular formula C13H25Cl2NO2
and a molecular weight of 298.25 g/mol. Its IUPAC name is 1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride.
Molecular Properties
| Compound Name | 1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride |
| PubChem CID | 175329155 |
| Molecular Formula | C13H25Cl2NO2 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride |
| SMILES | CCCCC(=O)N(C)CC(=O)Cl.CCCCCCl |
| InChI | InChI=1S/C8H14ClNO2.C5H11Cl/c1-3-4-5-8(12)10(2)6-7(9)11;1-2-3-4-5-6/h3-6H2,1-2H3;2-5H2,1H3 |
| InChIKey | LQMJZZYZLCNGCY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride?
The IUPAC name of 1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride (CID 175329155) is 1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride.
What is the SMILES notation for 1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride?
The canonical SMILES for 1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride is CCCCC(=O)N(C)CC(=O)Cl.CCCCCCl.
What is the InChIKey of 1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride?
The InChIKey is LQMJZZYZLCNGCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClNO2.C5H11Cl/c1-3-4-5-8(12)10(2)6-7(9)11;1-2-3-4-5-6/h3-6H2,1-2H3;2-5H2,1H3.
What are the key properties of 1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride?
1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride has a molecular weight of 298.25 g/mol, XLogP of 3.82, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentane;2-[methyl(pentanoyl)amino]acetyl chloride is sourced from PubChem (CID 175329155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).