hydrogen sulfite;hydron;hexafluorophosphate

H2F6O3PS- — CID 175329476

IUPAChydrogen sulfite;hydron;hexafluorophosphate
SMILESF[P-](F)(F)(F)(F)F.O=S([O-])O.[H+]
InChIInChI=1S/F6P.H2O3S/c1-7(2,3,4,5)6;1-4(2)3/h;(H2,1,2,3)/q-1;
InChIKeyZHFOTZWYQCOMDD-UHFFFAOYSA-N
MW227.04 g/mol
LogP2.83
Rot. Bonds

About hydrogen sulfite;hydron;hexafluorophosphate

hydrogen sulfite;hydron;hexafluorophosphate (PubChem CID 175329476) has the molecular formula H2F6O3PS- and a molecular weight of 227.04 g/mol. Its IUPAC name is hydrogen sulfite;hydron;hexafluorophosphate.

Molecular Properties

Compound Namehydrogen sulfite;hydron;hexafluorophosphate
PubChem CID175329476
Molecular FormulaH2F6O3PS-
Molecular Weight227.04 g/mol
Exact Mass226.94
IUPAC Namehydrogen sulfite;hydron;hexafluorophosphate
SMILESF[P-](F)(F)(F)(F)F.O=S([O-])O.[H+]
InChIInChI=1S/F6P.H2O3S/c1-7(2,3,4,5)6;1-4(2)3/h;(H2,1,2,3)/q-1;
InChIKeyZHFOTZWYQCOMDD-UHFFFAOYSA-N
XLogP2.83
TPSA60.36 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.04
LogP ≤ 52.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze hydrogen sulfite;hydron;hexafluorophosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen sulfite;hydron;hexafluorophosphate?
The IUPAC name of hydrogen sulfite;hydron;hexafluorophosphate (CID 175329476) is hydrogen sulfite;hydron;hexafluorophosphate.
What is the SMILES notation for hydrogen sulfite;hydron;hexafluorophosphate?
The canonical SMILES for hydrogen sulfite;hydron;hexafluorophosphate is F[P-](F)(F)(F)(F)F.O=S([O-])O.[H+].
What is the InChIKey of hydrogen sulfite;hydron;hexafluorophosphate?
The InChIKey is ZHFOTZWYQCOMDD-UHFFFAOYSA-N. The full InChI is InChI=1S/F6P.H2O3S/c1-7(2,3,4,5)6;1-4(2)3/h;(H2,1,2,3)/q-1;.
What are the key properties of hydrogen sulfite;hydron;hexafluorophosphate?
hydrogen sulfite;hydron;hexafluorophosphate has a molecular weight of 227.04 g/mol, XLogP of 2.83, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfite;hydron;hexafluorophosphate is sourced from PubChem (CID 175329476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).