C15H24NNa — CID 175329536
sodium;hydride;2,2,6,6-tetramethyl-1-phenylpiperidine (PubChem CID 175329536) has the molecular formula C15H24NNa and a molecular weight of 241.35 g/mol. Its IUPAC name is sodium;hydride;2,2,6,6-tetramethyl-1-phenylpiperidine.
| Compound Name | sodium;hydride;2,2,6,6-tetramethyl-1-phenylpiperidine |
|---|---|
| PubChem CID | 175329536 |
| Molecular Formula | C15H24NNa |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | sodium;hydride;2,2,6,6-tetramethyl-1-phenylpiperidine |
| SMILES | CC1(C)CCCC(C)(C)N1c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C15H23N.Na.H/c1-14(2)11-8-12-15(3,4)16(14)13-9-6-5-7-10-13;;/h5-7,9-10H,8,11-12H2,1-4H3;;/q;+1;-1 |
| InChIKey | JSTXTRHMPFDJBU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |