C8H13N3O4 — CID 175329743
5-amino-5-oxo-2-(2-prop-2-enoylhydrazinyl)pentanoic acid (PubChem CID 175329743) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is 5-amino-5-oxo-2-(2-prop-2-enoylhydrazinyl)pentanoic acid.
| Compound Name | 5-amino-5-oxo-2-(2-prop-2-enoylhydrazinyl)pentanoic acid |
|---|---|
| PubChem CID | 175329743 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 5-amino-5-oxo-2-(2-prop-2-enoylhydrazinyl)pentanoic acid |
| SMILES | C=CC(=O)NNC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H13N3O4/c1-2-7(13)11-10-5(8(14)15)3-4-6(9)12/h2,5,10H,1,3-4H2,(H2,9,12)(H,11,13)(H,14,15) |
| InChIKey | OYPLOCNBYSWGRZ-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|