About benzyl acetate;formonitrile
benzyl acetate;formonitrile (PubChem CID 175329925) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is benzyl acetate;formonitrile.
Molecular Properties
| Compound Name | benzyl acetate;formonitrile |
| PubChem CID | 175329925 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | benzyl acetate;formonitrile |
| SMILES | C#N.CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C9H10O2.CHN/c1-8(10)11-7-9-5-3-2-4-6-9;1-2/h2-6H,7H2,1H3;1H |
| InChIKey | AKRCVEDSANJLOZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl acetate;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl acetate;formonitrile?
The IUPAC name of benzyl acetate;formonitrile (CID 175329925) is benzyl acetate;formonitrile.
What is the SMILES notation for benzyl acetate;formonitrile?
The canonical SMILES for benzyl acetate;formonitrile is C#N.CC(=O)OCc1ccccc1.
What is the InChIKey of benzyl acetate;formonitrile?
The InChIKey is AKRCVEDSANJLOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.CHN/c1-8(10)11-7-9-5-3-2-4-6-9;1-2/h2-6H,7H2,1H3;1H.
What are the key properties of benzyl acetate;formonitrile?
benzyl acetate;formonitrile has a molecular weight of 177.20 g/mol, XLogP of 1.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl acetate;formonitrile is sourced from PubChem (CID 175329925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).