About 4-bromocyclohexene;2-pyridin-3-ylpyridine
4-bromocyclohexene;2-pyridin-3-ylpyridine (PubChem CID 175330068) has the molecular formula C16H17BrN2
and a molecular weight of 317.23 g/mol. Its IUPAC name is 4-bromocyclohexene;2-pyridin-3-ylpyridine.
Molecular Properties
| Compound Name | 4-bromocyclohexene;2-pyridin-3-ylpyridine |
| PubChem CID | 175330068 |
| Molecular Formula | C16H17BrN2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-bromocyclohexene;2-pyridin-3-ylpyridine |
| SMILES | BrC1CC=CCC1.c1ccc(-c2cccnc2)nc1 |
| InChI | InChI=1S/C10H8N2.C6H9Br/c1-2-7-12-10(5-1)9-4-3-6-11-8-9;7-6-4-2-1-3-5-6/h1-8H;1-2,6H,3-5H2 |
| InChIKey | UXRAERFTQIJLJI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-bromocyclohexene;2-pyridin-3-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromocyclohexene;2-pyridin-3-ylpyridine?
The IUPAC name of 4-bromocyclohexene;2-pyridin-3-ylpyridine (CID 175330068) is 4-bromocyclohexene;2-pyridin-3-ylpyridine.
What is the SMILES notation for 4-bromocyclohexene;2-pyridin-3-ylpyridine?
The canonical SMILES for 4-bromocyclohexene;2-pyridin-3-ylpyridine is BrC1CC=CCC1.c1ccc(-c2cccnc2)nc1.
What is the InChIKey of 4-bromocyclohexene;2-pyridin-3-ylpyridine?
The InChIKey is UXRAERFTQIJLJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C6H9Br/c1-2-7-12-10(5-1)9-4-3-6-11-8-9;7-6-4-2-1-3-5-6/h1-8H;1-2,6H,3-5H2.
What are the key properties of 4-bromocyclohexene;2-pyridin-3-ylpyridine?
4-bromocyclohexene;2-pyridin-3-ylpyridine has a molecular weight of 317.23 g/mol, XLogP of 4.63, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromocyclohexene;2-pyridin-3-ylpyridine is sourced from PubChem (CID 175330068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).