About anilino methanesulfonate;1H-imidazole
anilino methanesulfonate;1H-imidazole (PubChem CID 175330405) has the molecular formula C10H13N3O3S
and a molecular weight of 255.30 g/mol. Its IUPAC name is anilino methanesulfonate;1H-imidazole.
Molecular Properties
| Compound Name | anilino methanesulfonate;1H-imidazole |
| PubChem CID | 175330405 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | anilino methanesulfonate;1H-imidazole |
| SMILES | CS(=O)(=O)ONc1ccccc1.c1c[nH]cn1 |
| InChI | InChI=1S/C7H9NO3S.C3H4N2/c1-12(9,10)11-8-7-5-3-2-4-6-7;1-2-5-3-4-1/h2-6,8H,1H3;1-3H,(H,4,5) |
| InChIKey | DCYDGVQJAFMASN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze anilino methanesulfonate;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anilino methanesulfonate;1H-imidazole?
The IUPAC name of anilino methanesulfonate;1H-imidazole (CID 175330405) is anilino methanesulfonate;1H-imidazole.
What is the SMILES notation for anilino methanesulfonate;1H-imidazole?
The canonical SMILES for anilino methanesulfonate;1H-imidazole is CS(=O)(=O)ONc1ccccc1.c1c[nH]cn1.
What is the InChIKey of anilino methanesulfonate;1H-imidazole?
The InChIKey is DCYDGVQJAFMASN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S.C3H4N2/c1-12(9,10)11-8-7-5-3-2-4-6-7;1-2-5-3-4-1/h2-6,8H,1H3;1-3H,(H,4,5).
What are the key properties of anilino methanesulfonate;1H-imidazole?
anilino methanesulfonate;1H-imidazole has a molecular weight of 255.30 g/mol, XLogP of 1.40, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for anilino methanesulfonate;1H-imidazole is sourced from PubChem (CID 175330405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).