C7H12F6N2 — CID 175330511
1,1,1,3,3,3-hexafluoropropane;piperazine (PubChem CID 175330511) has the molecular formula C7H12F6N2 and a molecular weight of 238.17 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropane;piperazine.
| Compound Name | 1,1,1,3,3,3-hexafluoropropane;piperazine |
|---|---|
| PubChem CID | 175330511 |
| Molecular Formula | C7H12F6N2 |
| Molecular Weight | 238.17 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropane;piperazine |
| SMILES | C1CNCCN1.FC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C4H10N2.C3H2F6/c1-2-6-4-3-5-1;4-2(5,6)1-3(7,8)9/h5-6H,1-4H2;1H2 |
| InChIKey | HKABTBFWUFFNLQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |