About 1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine
1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine (PubChem CID 175330758) has the molecular formula C16H5ClF4N2S
and a molecular weight of 368.74 g/mol. Its IUPAC name is 1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine.
Molecular Properties
| Compound Name | 1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine |
| PubChem CID | 175330758 |
| Molecular Formula | C16H5ClF4N2S |
| Molecular Weight | 368.74 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine |
| SMILES | Fc1c(F)c(F)c2c(-c3scc4ccccc34)nnc(Cl)c2c1F |
| InChI | InChI=1S/C16H5ClF4N2S/c17-16-9-8(10(18)12(20)13(21)11(9)19)14(22-23-16)15-7-4-2-1-3-6(7)5-24-15/h1-5H |
| InChIKey | FZHFBCWURLJHIH-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.74 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine?
The IUPAC name of 1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine (CID 175330758) is 1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine.
What is the SMILES notation for 1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine?
The canonical SMILES for 1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine is Fc1c(F)c(F)c2c(-c3scc4ccccc34)nnc(Cl)c2c1F.
What is the InChIKey of 1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine?
The InChIKey is FZHFBCWURLJHIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H5ClF4N2S/c17-16-9-8(10(18)12(20)13(21)11(9)19)14(22-23-16)15-7-4-2-1-3-6(7)5-24-15/h1-5H.
What are the key properties of 1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine?
1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine has a molecular weight of 368.74 g/mol, XLogP of 5.72, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-benzothiophen-1-yl)-4-chloro-5,6,7,8-tetrafluorophthalazine is sourced from PubChem (CID 175330758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).