C21H25NO4S — CID 175331330
[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-phenyl-2-(2-thiocyanatoacetyl)oxyacetate (PubChem CID 175331330) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is [(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-phenyl-2-(2-thiocyanatoacetyl)oxyacetate.
| Compound Name | [(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-phenyl-2-(2-thiocyanatoacetyl)oxyacetate |
|---|---|
| PubChem CID | 175331330 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] 2-phenyl-2-(2-thiocyanatoacetyl)oxyacetate |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)C(OC(=O)C(OC(=O)CSC#N)c1ccccc1)C2 |
| InChI | InChI=1S/C21H25NO4S/c1-20(2)15-9-10-21(20,3)16(11-15)25-19(24)18(14-7-5-4-6-8-14)26-17(23)12-27-13-22/h4-8,15-16,18H,9-12H2,1-3H3/t15-,16?,18?,21-/m1/s1 |
| InChIKey | AZGMHEYNNBTGFU-BEVROLAMSA-N |
| XLogP | 4.24 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|