C24H21F4N5O4 — CID 175332114
5-(1-azidoethyl)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-N-[(2,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide (PubChem CID 175332114) has the molecular formula C24H21F4N5O4 and a molecular weight of 519.46 g/mol. Its IUPAC name is 5-(1-azidoethyl)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-N-[(2,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 5-(1-azidoethyl)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-N-[(2,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 175332114 |
| Molecular Formula | C24H21F4N5O4 |
| Molecular Weight | 519.46 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | 5-(1-azidoethyl)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-N-[(2,4-difluorophenyl)methyl]-1,3-oxazole-4-carboxamide |
| SMILES | CC(N=[N+]=[N-])c1oc(-c2ccc(OC(F)F)c(OCC3CC3)c2)nc1C(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C24H21F4N5O4/c1-12(32-33-29)21-20(22(34)30-10-15-4-6-16(25)9-17(15)26)31-23(37-21)14-5-7-18(36-24(27)28)19(8-14)35-11-13-2-3-13/h4-9,12-13,24H,2-3,10-11H2,1H3,(H,30,34) |
| InChIKey | PYELXCTWRKZGCS-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 122.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.46 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|