About hydron;1,1,2-trifluoroethane
hydron;1,1,2-trifluoroethane (PubChem CID 175332143) has the molecular formula C2H4F3+
and a molecular weight of 85.05 g/mol. Its IUPAC name is hydron;1,1,2-trifluoroethane.
Molecular Properties
| Compound Name | hydron;1,1,2-trifluoroethane |
| PubChem CID | 175332143 |
| Molecular Formula | C2H4F3+ |
| Molecular Weight | 85.05 g/mol |
| Exact Mass | 85.03 |
| IUPAC Name | hydron;1,1,2-trifluoroethane |
| SMILES | FCC(F)F.[H+] |
| InChI | InChI=1S/C2H3F3/c3-1-2(4)5/h2H,1H2/p+1 |
| InChIKey | WGZYQOSEVSXDNI-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.05 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hydron;1,1,2-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;1,1,2-trifluoroethane?
The IUPAC name of hydron;1,1,2-trifluoroethane (CID 175332143) is hydron;1,1,2-trifluoroethane.
What is the SMILES notation for hydron;1,1,2-trifluoroethane?
The canonical SMILES for hydron;1,1,2-trifluoroethane is FCC(F)F.[H+].
What is the InChIKey of hydron;1,1,2-trifluoroethane?
The InChIKey is WGZYQOSEVSXDNI-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H3F3/c3-1-2(4)5/h2H,1H2/p+1.
What are the key properties of hydron;1,1,2-trifluoroethane?
hydron;1,1,2-trifluoroethane has a molecular weight of 85.05 g/mol, XLogP of 1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;1,1,2-trifluoroethane is sourced from PubChem (CID 175332143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).