C15H18 — CID 175332216
1-methyl-2,4,6,8-tetramethylideneadamantane (PubChem CID 175332216) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-methyl-2,4,6,8-tetramethylideneadamantane.
| Compound Name | 1-methyl-2,4,6,8-tetramethylideneadamantane |
|---|---|
| PubChem CID | 175332216 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-methyl-2,4,6,8-tetramethylideneadamantane |
| SMILES | C=C1C2CC3(C)C(=C)C1CC(C2=C)C3=C |
| InChI | InChI=1S/C15H18/c1-8-12-6-13-9(2)14(8)7-15(5,10(12)3)11(13)4/h12-14H,1-4,6-7H2,5H3 |
| InChIKey | OVTWXFCWFKBPOG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|