C11H16O4 — CID 175332290
2-[[4-(hydroxymethyl)phenoxy]methyl]propane-1,3-diol (PubChem CID 175332290) has the molecular formula C11H16O4 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[[4-(hydroxymethyl)phenoxy]methyl]propane-1,3-diol.
| Compound Name | 2-[[4-(hydroxymethyl)phenoxy]methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 175332290 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-[[4-(hydroxymethyl)phenoxy]methyl]propane-1,3-diol |
| SMILES | OCc1ccc(OCC(CO)CO)cc1 |
| InChI | InChI=1S/C11H16O4/c12-5-9-1-3-11(4-2-9)15-8-10(6-13)7-14/h1-4,10,12-14H,5-8H2 |
| InChIKey | NWBFHTAPZKSSFC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |