About 2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid
2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid (PubChem CID 175332727) has the molecular formula C15H14Cl2O3S
and a molecular weight of 345.25 g/mol. Its IUPAC name is 2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid |
| PubChem CID | 175332727 |
| Molecular Formula | C15H14Cl2O3S |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(C(C)c2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C15H14Cl2O3S/c1-9-3-4-15(21(18,19)20)14(5-9)10(2)11-6-12(16)8-13(17)7-11/h3-8,10H,1-2H3,(H,18,19,20) |
| InChIKey | OTTBVMAHIBMDBJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid?
The IUPAC name of 2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid (CID 175332727) is 2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid.
What is the SMILES notation for 2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid?
The canonical SMILES for 2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)c(C(C)c2cc(Cl)cc(Cl)c2)c1.
What is the InChIKey of 2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid?
The InChIKey is OTTBVMAHIBMDBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14Cl2O3S/c1-9-3-4-15(21(18,19)20)14(5-9)10(2)11-6-12(16)8-13(17)7-11/h3-8,10H,1-2H3,(H,18,19,20).
What are the key properties of 2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid?
2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid has a molecular weight of 345.25 g/mol, XLogP of 4.70, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,5-dichlorophenyl)ethyl]-4-methylbenzenesulfonic acid is sourced from PubChem (CID 175332727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).