About ethanimine;2-methylprop-2-enoic acid
ethanimine;2-methylprop-2-enoic acid (PubChem CID 175333202) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is ethanimine;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | ethanimine;2-methylprop-2-enoic acid |
| PubChem CID | 175333202 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | ethanimine;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.[H]/N=C/C |
| InChI | InChI=1S/C4H6O2.C2H5N/c1-3(2)4(5)6;1-2-3/h1H2,2H3,(H,5,6);2-3H,1H3/b;3-2+ |
| InChIKey | GAVXFLCVGNXMAC-ZPYUXNTASA-N |
| XLogP | 1.30 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethanimine;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanimine;2-methylprop-2-enoic acid?
The IUPAC name of ethanimine;2-methylprop-2-enoic acid (CID 175333202) is ethanimine;2-methylprop-2-enoic acid.
What is the SMILES notation for ethanimine;2-methylprop-2-enoic acid?
The canonical SMILES for ethanimine;2-methylprop-2-enoic acid is C=C(C)C(=O)O.[H]/N=C/C.
What is the InChIKey of ethanimine;2-methylprop-2-enoic acid?
The InChIKey is GAVXFLCVGNXMAC-ZPYUXNTASA-N. The full InChI is InChI=1S/C4H6O2.C2H5N/c1-3(2)4(5)6;1-2-3/h1H2,2H3,(H,5,6);2-3H,1H3/b;3-2+.
What are the key properties of ethanimine;2-methylprop-2-enoic acid?
ethanimine;2-methylprop-2-enoic acid has a molecular weight of 129.16 g/mol, XLogP of 1.30, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanimine;2-methylprop-2-enoic acid is sourced from PubChem (CID 175333202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).