About 2-bromofluoren-9-one;oxolane
2-bromofluoren-9-one;oxolane (PubChem CID 175333740) has the molecular formula C17H15BrO2
and a molecular weight of 331.21 g/mol. Its IUPAC name is 2-bromofluoren-9-one;oxolane.
Molecular Properties
| Compound Name | 2-bromofluoren-9-one;oxolane |
| PubChem CID | 175333740 |
| Molecular Formula | C17H15BrO2 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-bromofluoren-9-one;oxolane |
| SMILES | C1CCOC1.O=C1c2ccccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C13H7BrO.C4H8O/c14-8-5-6-10-9-3-1-2-4-11(9)13(15)12(10)7-8;1-2-4-5-3-1/h1-7H;1-4H2 |
| InChIKey | QFPBXWDFLWPYBR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromofluoren-9-one;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromofluoren-9-one;oxolane?
The IUPAC name of 2-bromofluoren-9-one;oxolane (CID 175333740) is 2-bromofluoren-9-one;oxolane.
What is the SMILES notation for 2-bromofluoren-9-one;oxolane?
The canonical SMILES for 2-bromofluoren-9-one;oxolane is C1CCOC1.O=C1c2ccccc2-c2ccc(Br)cc21.
What is the InChIKey of 2-bromofluoren-9-one;oxolane?
The InChIKey is QFPBXWDFLWPYBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrO.C4H8O/c14-8-5-6-10-9-3-1-2-4-11(9)13(15)12(10)7-8;1-2-4-5-3-1/h1-7H;1-4H2.
What are the key properties of 2-bromofluoren-9-one;oxolane?
2-bromofluoren-9-one;oxolane has a molecular weight of 331.21 g/mol, XLogP of 4.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromofluoren-9-one;oxolane is sourced from PubChem (CID 175333740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).