About 1-methylacridine;hydrochloride
1-methylacridine;hydrochloride (PubChem CID 175333750) has the molecular formula C14H12ClN
and a molecular weight of 229.71 g/mol. Its IUPAC name is 1-methylacridine;hydrochloride.
Molecular Properties
| Compound Name | 1-methylacridine;hydrochloride |
| PubChem CID | 175333750 |
| Molecular Formula | C14H12ClN |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 1-methylacridine;hydrochloride |
| SMILES | Cc1cccc2nc3ccccc3cc12.Cl |
| InChI | InChI=1S/C14H11N.ClH/c1-10-5-4-8-14-12(10)9-11-6-2-3-7-13(11)15-14;/h2-9H,1H3;1H |
| InChIKey | OVFAZNQAMWVGGE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methylacridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylacridine;hydrochloride?
The IUPAC name of 1-methylacridine;hydrochloride (CID 175333750) is 1-methylacridine;hydrochloride.
What is the SMILES notation for 1-methylacridine;hydrochloride?
The canonical SMILES for 1-methylacridine;hydrochloride is Cc1cccc2nc3ccccc3cc12.Cl.
What is the InChIKey of 1-methylacridine;hydrochloride?
The InChIKey is OVFAZNQAMWVGGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N.ClH/c1-10-5-4-8-14-12(10)9-11-6-2-3-7-13(11)15-14;/h2-9H,1H3;1H.
What are the key properties of 1-methylacridine;hydrochloride?
1-methylacridine;hydrochloride has a molecular weight of 229.71 g/mol, XLogP of 4.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylacridine;hydrochloride is sourced from PubChem (CID 175333750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).