C18H15N5O — CID 175334129
4-[(5-phenyl-1H-1,2,4-triazol-3-yl)amino]-2-prop-2-enoxybenzonitrile (PubChem CID 175334129) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-[(5-phenyl-1H-1,2,4-triazol-3-yl)amino]-2-prop-2-enoxybenzonitrile.
| Compound Name | 4-[(5-phenyl-1H-1,2,4-triazol-3-yl)amino]-2-prop-2-enoxybenzonitrile |
|---|---|
| PubChem CID | 175334129 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 4-[(5-phenyl-1H-1,2,4-triazol-3-yl)amino]-2-prop-2-enoxybenzonitrile |
| SMILES | C=CCOc1cc(Nc2n[nH]c(-c3ccccc3)n2)ccc1C#N |
| InChI | InChI=1S/C18H15N5O/c1-2-10-24-16-11-15(9-8-14(16)12-19)20-18-21-17(22-23-18)13-6-4-3-5-7-13/h2-9,11H,1,10H2,(H2,20,21,22,23) |
| InChIKey | WPVVELCORUABMP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|