About 3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol
3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol (PubChem CID 175334423) has the molecular formula C11H11F2NO
and a molecular weight of 211.21 g/mol. Its IUPAC name is 3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol.
Molecular Properties
| Compound Name | 3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol |
| PubChem CID | 175334423 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol |
| SMILES | OC1(C(F)C=CF)CNc2ccccc21 |
| InChI | InChI=1S/C11H11F2NO/c12-6-5-10(13)11(15)7-14-9-4-2-1-3-8(9)11/h1-6,10,14-15H,7H2 |
| InChIKey | QFPMLDWDOLCCSX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol?
The IUPAC name of 3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol (CID 175334423) is 3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol.
What is the SMILES notation for 3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol?
The canonical SMILES for 3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol is OC1(C(F)C=CF)CNc2ccccc21.
What is the InChIKey of 3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol?
The InChIKey is QFPMLDWDOLCCSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO/c12-6-5-10(13)11(15)7-14-9-4-2-1-3-8(9)11/h1-6,10,14-15H,7H2.
What are the key properties of 3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol?
3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol has a molecular weight of 211.21 g/mol, XLogP of 2.12, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-difluoroprop-2-enyl)-1,2-dihydroindol-3-ol is sourced from PubChem (CID 175334423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).