About bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone
bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone (PubChem CID 175334723) has the molecular formula C15H24N2O3
and a molecular weight of 280.37 g/mol. Its IUPAC name is bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone.
Molecular Properties
| Compound Name | bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone |
| PubChem CID | 175334723 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone |
| SMILES | CC(C)(C)C1COC(C(=O)C2=NC(C(C)(C)C)CO2)=N1 |
| InChI | InChI=1S/C15H24N2O3/c1-14(2,3)9-7-19-12(16-9)11(18)13-17-10(8-20-13)15(4,5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | KTXMZRMRKNPBPB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone?
The IUPAC name of bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone (CID 175334723) is bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone.
What is the SMILES notation for bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone?
The canonical SMILES for bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone is CC(C)(C)C1COC(C(=O)C2=NC(C(C)(C)C)CO2)=N1.
What is the InChIKey of bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone?
The InChIKey is KTXMZRMRKNPBPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O3/c1-14(2,3)9-7-19-12(16-9)11(18)13-17-10(8-20-13)15(4,5)6/h9-10H,7-8H2,1-6H3.
What are the key properties of bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone?
bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone has a molecular weight of 280.37 g/mol, XLogP of 2.24, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)methanone is sourced from PubChem (CID 175334723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).