C11H16BrN — CID 175334902
4-bromo-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carbonitrile (PubChem CID 175334902) has the molecular formula C11H16BrN and a molecular weight of 242.16 g/mol. Its IUPAC name is 4-bromo-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carbonitrile.
| Compound Name | 4-bromo-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 175334902 |
| Molecular Formula | C11H16BrN |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 4-bromo-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-carbonitrile |
| SMILES | N#CC1CCC(Br)C2CCCCC12 |
| InChI | InChI=1S/C11H16BrN/c12-11-6-5-8(7-13)9-3-1-2-4-10(9)11/h8-11H,1-6H2 |
| InChIKey | HCYDEZRHYNEAOQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|