About 6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline
6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline (PubChem CID 175335419) has the molecular formula C22H20ClFN2O3
and a molecular weight of 414.86 g/mol. Its IUPAC name is 6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline.
Molecular Properties
| Compound Name | 6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline |
| PubChem CID | 175335419 |
| Molecular Formula | C22H20ClFN2O3 |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline |
| SMILES | CC(C)Oc1ccc(Oc2nc3ccc(Cl)cc3o2)cc1.Nc1ccccc1F |
| InChI | InChI=1S/C16H14ClNO3.C6H6FN/c1-10(2)19-12-4-6-13(7-5-12)20-16-18-14-8-3-11(17)9-15(14)21-16;7-5-3-1-2-4-6(5)8/h3-10H,1-2H3;1-4H,8H2 |
| InChIKey | GBOXBYNGILWLKW-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline?
The IUPAC name of 6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline (CID 175335419) is 6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline.
What is the SMILES notation for 6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline?
The canonical SMILES for 6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline is CC(C)Oc1ccc(Oc2nc3ccc(Cl)cc3o2)cc1.Nc1ccccc1F.
What is the InChIKey of 6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline?
The InChIKey is GBOXBYNGILWLKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNO3.C6H6FN/c1-10(2)19-12-4-6-13(7-5-12)20-16-18-14-8-3-11(17)9-15(14)21-16;7-5-3-1-2-4-6(5)8/h3-10H,1-2H3;1-4H,8H2.
What are the key properties of 6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline?
6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline has a molecular weight of 414.86 g/mol, XLogP of 6.47, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(4-propan-2-yloxyphenoxy)-1,3-benzoxazole;2-fluoroaniline is sourced from PubChem (CID 175335419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).