About CID 175335611
CID 175335611 (PubChem CID 175335611) has the molecular formula C40H30Cl2S2SiZr
and a molecular weight of 765.03 g/mol.
Molecular Properties
| Compound Name | CID 175335611 |
| PubChem CID | 175335611 |
| Molecular Formula | C40H30Cl2S2SiZr |
| Molecular Weight | 765.03 g/mol |
| Exact Mass | 762.00 |
| IUPAC Name | — |
| SMILES | C1=C(c2cccs2)C(C[Si]CC2C(c3cccs3)=Cc3c(-c4ccccc4)cccc32)c2cccc(-c3ccccc3)c21.Cl[Zr]Cl |
| InChI | InChI=1S/C40H30S2Si.2ClH.Zr/c1-3-11-27(12-4-1)29-15-7-17-31-33(29)23-35(39-19-9-21-41-39)37(31)25-43-26-38-32-18-8-16-30(28-13-5-2-6-14-28)34(32)24-36(38)40-20-10-22-42-40;;;/h1-24,37-38H,25-26H2;2*1H;/q;;;+2/p-2 |
| InChIKey | XFPQFSIEVJDPPF-UHFFFAOYSA-L |
| XLogP | 13.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 765.03 |
| LogP ≤ 5 | 13.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175335611 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175335611?
The IUPAC name of CID 175335611 (CID 175335611) is not available.
What is the SMILES notation for CID 175335611?
The canonical SMILES for CID 175335611 is C1=C(c2cccs2)C(C[Si]CC2C(c3cccs3)=Cc3c(-c4ccccc4)cccc32)c2cccc(-c3ccccc3)c21.Cl[Zr]Cl.
What is the InChIKey of CID 175335611?
The InChIKey is XFPQFSIEVJDPPF-UHFFFAOYSA-L. The full InChI is InChI=1S/C40H30S2Si.2ClH.Zr/c1-3-11-27(12-4-1)29-15-7-17-31-33(29)23-35(39-19-9-21-41-39)37(31)25-43-26-38-32-18-8-16-30(28-13-5-2-6-14-28)34(32)24-36(38)40-20-10-22-42-40;;;/h1-24,37-38H,25-26H2;2*1H;/q;;;+2/p-2.
What are the key properties of CID 175335611?
CID 175335611 has a molecular weight of 765.03 g/mol, XLogP of 13.04, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175335611 is sourced from PubChem (CID 175335611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).