About CID 175335661
CID 175335661 (PubChem CID 175335661) has the molecular formula C46H40Cl4O2SiZr
and a molecular weight of 885.95 g/mol.
Molecular Properties
| Compound Name | CID 175335661 |
| PubChem CID | 175335661 |
| Molecular Formula | C46H40Cl4O2SiZr |
| Molecular Weight | 885.95 g/mol |
| Exact Mass | 882.06 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C2=Cc3c(cc(C)c(C)c3-c3ccc(Cl)cc3)C2C[Si]CC2C(c3ccc(C)o3)=Cc3c2cc(C)c(C)c3-c2ccc(Cl)cc2)o1.Cl[Zr]Cl |
| InChI | InChI=1S/C46H40Cl2O2Si.2ClH.Zr/c1-25-19-35-39(45(29(25)5)31-9-13-33(47)14-10-31)21-37(43-17-7-27(3)49-43)41(35)23-51-24-42-36-20-26(2)30(6)46(32-11-15-34(48)16-12-32)40(36)22-38(42)44-18-8-28(4)50-44;;;/h7-22,41-42H,23-24H2,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | YBGNWSRSADNXLN-UHFFFAOYSA-L |
| XLogP | 15.26 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 885.95 |
| LogP ≤ 5 | 15.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175335661 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175335661?
The IUPAC name of CID 175335661 (CID 175335661) is not available.
What is the SMILES notation for CID 175335661?
The canonical SMILES for CID 175335661 is Cc1ccc(C2=Cc3c(cc(C)c(C)c3-c3ccc(Cl)cc3)C2C[Si]CC2C(c3ccc(C)o3)=Cc3c2cc(C)c(C)c3-c2ccc(Cl)cc2)o1.Cl[Zr]Cl.
What is the InChIKey of CID 175335661?
The InChIKey is YBGNWSRSADNXLN-UHFFFAOYSA-L. The full InChI is InChI=1S/C46H40Cl2O2Si.2ClH.Zr/c1-25-19-35-39(45(29(25)5)31-9-13-33(47)14-10-31)21-37(43-17-7-27(3)49-43)41(35)23-51-24-42-36-20-26(2)30(6)46(32-11-15-34(48)16-12-32)40(36)22-38(42)44-18-8-28(4)50-44;;;/h7-22,41-42H,23-24H2,1-6H3;2*1H;/q;;;+2/p-2.
What are the key properties of CID 175335661?
CID 175335661 has a molecular weight of 885.95 g/mol, XLogP of 15.26, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175335661 is sourced from PubChem (CID 175335661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).