About CID 175335676
CID 175335676 (PubChem CID 175335676) has the molecular formula C46H42S2Si
and a molecular weight of 687.06 g/mol.
Molecular Properties
| Compound Name | CID 175335676 |
| PubChem CID | 175335676 |
| Molecular Formula | C46H42S2Si |
| Molecular Weight | 687.06 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C2=Cc3c(cc(C)c(C)c3-c3ccccc3)C2C[Si]CC2C(c3ccc(C)s3)=Cc3c2cc(C)c(C)c3-c2ccccc2)s1 |
| InChI | InChI=1S/C46H42S2Si/c1-27-21-35-39(45(31(27)5)33-13-9-7-10-14-33)23-37(43-19-17-29(3)47-43)41(35)25-49-26-42-36-22-28(2)32(6)46(34-15-11-8-12-16-34)40(36)24-38(42)44-20-18-30(4)48-44/h7-24,41-42H,25-26H2,1-6H3 |
| InChIKey | BFJGYAZACPIOPC-UHFFFAOYSA-N |
| XLogP | 13.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 687.06 |
| LogP ≤ 5 | 13.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175335676 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175335676?
The IUPAC name of CID 175335676 (CID 175335676) is not available.
What is the SMILES notation for CID 175335676?
The canonical SMILES for CID 175335676 is Cc1ccc(C2=Cc3c(cc(C)c(C)c3-c3ccccc3)C2C[Si]CC2C(c3ccc(C)s3)=Cc3c2cc(C)c(C)c3-c2ccccc2)s1.
What is the InChIKey of CID 175335676?
The InChIKey is BFJGYAZACPIOPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C46H42S2Si/c1-27-21-35-39(45(31(27)5)33-13-9-7-10-14-33)23-37(43-19-17-29(3)47-43)41(35)25-49-26-42-36-22-28(2)32(6)46(34-15-11-8-12-16-34)40(36)24-38(42)44-20-18-30(4)48-44/h7-24,41-42H,25-26H2,1-6H3.
What are the key properties of CID 175335676?
CID 175335676 has a molecular weight of 687.06 g/mol, XLogP of 13.51, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175335676 is sourced from PubChem (CID 175335676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).