About CID 175335700
CID 175335700 (PubChem CID 175335700) has the molecular formula C44H38S2Si
and a molecular weight of 659.01 g/mol.
Molecular Properties
| Compound Name | CID 175335700 |
| PubChem CID | 175335700 |
| Molecular Formula | C44H38S2Si |
| Molecular Weight | 659.01 g/mol |
| Exact Mass | 658.22 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C2=Cc3c(ccc(C)c3-c3ccccc3)C2C[Si]CC2C(c3ccc(C)s3)=Cc3c2ccc(C)c3-c2ccccc2)s1 |
| InChI | InChI=1S/C44H38S2Si/c1-27-15-19-33-37(43(27)31-11-7-5-8-12-31)23-35(41-21-17-29(3)45-41)39(33)25-47-26-40-34-20-16-28(2)44(32-13-9-6-10-14-32)38(34)24-36(40)42-22-18-30(4)46-42/h5-24,39-40H,25-26H2,1-4H3 |
| InChIKey | QFLYYHGVXCVCNL-UHFFFAOYSA-N |
| XLogP | 12.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 659.01 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175335700 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175335700?
The IUPAC name of CID 175335700 (CID 175335700) is not available.
What is the SMILES notation for CID 175335700?
The canonical SMILES for CID 175335700 is Cc1ccc(C2=Cc3c(ccc(C)c3-c3ccccc3)C2C[Si]CC2C(c3ccc(C)s3)=Cc3c2ccc(C)c3-c2ccccc2)s1.
What is the InChIKey of CID 175335700?
The InChIKey is QFLYYHGVXCVCNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C44H38S2Si/c1-27-15-19-33-37(43(27)31-11-7-5-8-12-31)23-35(41-21-17-29(3)45-41)39(33)25-47-26-40-34-20-16-28(2)44(32-13-9-6-10-14-32)38(34)24-36(40)42-22-18-30(4)46-42/h5-24,39-40H,25-26H2,1-4H3.
What are the key properties of CID 175335700?
CID 175335700 has a molecular weight of 659.01 g/mol, XLogP of 12.89, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175335700 is sourced from PubChem (CID 175335700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).