About ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate
ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate (PubChem CID 175337402) has the molecular formula C17H23NO7
and a molecular weight of 353.37 g/mol. Its IUPAC name is ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate.
Molecular Properties
| Compound Name | ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate |
| PubChem CID | 175337402 |
| Molecular Formula | C17H23NO7 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate |
| SMILES | CCOC(=O)CCC(c1ccc(OC)cc1C1OCCCO1)[N+](=O)[O-] |
| InChI | InChI=1S/C17H23NO7/c1-3-23-16(19)8-7-15(18(20)21)13-6-5-12(22-2)11-14(13)17-24-9-4-10-25-17/h5-6,11,15,17H,3-4,7-10H2,1-2H3 |
| InChIKey | OONNJUTVOYXHKQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate?
The IUPAC name of ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate (CID 175337402) is ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate.
What is the SMILES notation for ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate?
The canonical SMILES for ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate is CCOC(=O)CCC(c1ccc(OC)cc1C1OCCCO1)[N+](=O)[O-].
What is the InChIKey of ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate?
The InChIKey is OONNJUTVOYXHKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO7/c1-3-23-16(19)8-7-15(18(20)21)13-6-5-12(22-2)11-14(13)17-24-9-4-10-25-17/h5-6,11,15,17H,3-4,7-10H2,1-2H3.
What are the key properties of ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate?
ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate has a molecular weight of 353.37 g/mol, XLogP of 2.79, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4-nitrobutanoate is sourced from PubChem (CID 175337402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).