About 4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine
4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine (PubChem CID 175337597) has the molecular formula C13H16F2N4O
and a molecular weight of 282.29 g/mol. Its IUPAC name is 4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine |
| PubChem CID | 175337597 |
| Molecular Formula | C13H16F2N4O |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine |
| SMILES | NC(=O)C1CNCCC1(F)F.c1cnc2cc[nH]c2c1 |
| InChI | InChI=1S/C7H6N2.C6H10F2N2O/c1-2-6-7(8-4-1)3-5-9-6;7-6(8)1-2-10-3-4(6)5(9)11/h1-5,9H;4,10H,1-3H2,(H2,9,11) |
| InChIKey | AMUFRNASFTUIMI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine (CID 175337597) is 4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine is NC(=O)C1CNCCC1(F)F.c1cnc2cc[nH]c2c1.
What is the InChIKey of 4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine?
The InChIKey is AMUFRNASFTUIMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C6H10F2N2O/c1-2-6-7(8-4-1)3-5-9-6;7-6(8)1-2-10-3-4(6)5(9)11/h1-5,9H;4,10H,1-3H2,(H2,9,11).
What are the key properties of 4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine?
4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine has a molecular weight of 282.29 g/mol, XLogP of 1.28, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoropiperidine-3-carboxamide;1H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 175337597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).