C8H5F9O — CID 175337705
1,3,3,4,4-pentafluoro-2-(2,2,3,3-tetrafluoropropoxy)cyclopentene (PubChem CID 175337705) has the molecular formula C8H5F9O and a molecular weight of 288.11 g/mol. Its IUPAC name is 1,3,3,4,4-pentafluoro-2-(2,2,3,3-tetrafluoropropoxy)cyclopentene.
| Compound Name | 1,3,3,4,4-pentafluoro-2-(2,2,3,3-tetrafluoropropoxy)cyclopentene |
|---|---|
| PubChem CID | 175337705 |
| Molecular Formula | C8H5F9O |
| Molecular Weight | 288.11 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 1,3,3,4,4-pentafluoro-2-(2,2,3,3-tetrafluoropropoxy)cyclopentene |
| SMILES | FC1=C(OCC(F)(F)C(F)F)C(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C8H5F9O/c9-3-1-7(14,15)8(16,17)4(3)18-2-6(12,13)5(10)11/h5H,1-2H2 |
| InChIKey | ZEWKKGSPBQAVRN-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.11 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|