C8H3F11O — CID 175337724
1,3,3,4,4-pentafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene (PubChem CID 175337724) has the molecular formula C8H3F11O and a molecular weight of 324.09 g/mol. Its IUPAC name is 1,3,3,4,4-pentafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene.
| Compound Name | 1,3,3,4,4-pentafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene |
|---|---|
| PubChem CID | 175337724 |
| Molecular Formula | C8H3F11O |
| Molecular Weight | 324.09 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 1,3,3,4,4-pentafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentene |
| SMILES | FC1=C(OC(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C8H3F11O/c9-2-1-5(10,11)6(12,13)3(2)20-4(7(14,15)16)8(17,18)19/h4H,1H2 |
| InChIKey | XQGGSTYULPAYNZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.09 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|