C7H2F10O — CID 175337729
1,3,4,4-tetrafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclobutene (PubChem CID 175337729) has the molecular formula C7H2F10O and a molecular weight of 292.07 g/mol. Its IUPAC name is 1,3,4,4-tetrafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclobutene.
| Compound Name | 1,3,4,4-tetrafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclobutene |
|---|---|
| PubChem CID | 175337729 |
| Molecular Formula | C7H2F10O |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 291.99 |
| IUPAC Name | 1,3,4,4-tetrafluoro-3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclobutene |
| SMILES | FC1=CC(F)(OC(C(F)(F)F)C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C7H2F10O/c8-2-1-4(9,5(2,10)11)18-3(6(12,13)14)7(15,16)17/h1,3H |
| InChIKey | JECZQBGQFJFHFW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |